C11H8N2O3S — CID 137244728
4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid (PubChem CID 137244728) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid.
| Compound Name | 4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 137244728 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]benzoic acid |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccc(C(=O)O)cc2)S1 |
| InChI | InChI=1S/C11H8N2O3S/c12-11-13-9(14)8(17-11)5-6-1-3-7(4-2-6)10(15)16/h1-5H,(H,15,16)(H2,12,13,14) |
| InChIKey | XAAJPLDVJNMAIC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|