C17H11IN2O3S — CID 171129862
[4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-iodobenzoate (PubChem CID 171129862) has the molecular formula C17H11IN2O3S and a molecular weight of 450.26 g/mol. Its IUPAC name is [4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 171129862 |
| Molecular Formula | C17H11IN2O3S |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | [4-[(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-iodobenzoate |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccc(OC(=O)c3ccccc3I)cc2)S1 |
| InChI | InChI=1S/C17H11IN2O3S/c18-13-4-2-1-3-12(13)16(22)23-11-7-5-10(6-8-11)9-14-15(21)20-17(19)24-14/h1-9H,(H2,19,20,21) |
| InChIKey | MERXXSIJILUWCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|