C18H12INO5S — CID 3686870
[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-iodobenzoate (PubChem CID 3686870) has the molecular formula C18H12INO5S and a molecular weight of 481.27 g/mol. Its IUPAC name is [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-iodobenzoate.
| Compound Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 3686870 |
| Molecular Formula | C18H12INO5S |
| Molecular Weight | 481.27 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] 2-iodobenzoate |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)ccc1OC(=O)c1ccccc1I |
| InChI | InChI=1S/C18H12INO5S/c1-24-14-8-10(9-15-16(21)20-18(23)26-15)6-7-13(14)25-17(22)11-4-2-3-5-12(11)19/h2-9H,1H3,(H,20,21,23) |
| InChIKey | YFDZLJBCSYPYHZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|