C29H22N2O4S — CID 137069788
[2-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 137069788) has the molecular formula C29H22N2O4S and a molecular weight of 494.57 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 137069788 |
| Molecular Formula | C29H22N2O4S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [2-methoxy-4-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(C)cc3)NC2=O)ccc1OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H22N2O4S/c1-18-10-13-21(14-11-18)30-29-31-27(32)26(36-29)17-19-12-15-24(25(16-19)34-2)35-28(33)23-9-5-7-20-6-3-4-8-22(20)23/h3-17H,1-2H3,(H,30,31,32)/b26-17- |
| InChIKey | XVRSSHAKCVDROT-ONUIUJJFSA-N |
| XLogP | 6.27 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|