C31H20N2O3S — CID 137043871
[1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate (PubChem CID 137043871) has the molecular formula C31H20N2O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is [1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate.
| Compound Name | [1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 137043871 |
| Molecular Formula | C31H20N2O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | [1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
| SMILES | O=C1N/C(=N\c2ccccc2)S/C1=C\c1c(OC(=O)c2cccc3ccccc23)ccc2ccccc12 |
| InChI | InChI=1S/C31H20N2O3S/c34-29-28(37-31(33-29)32-22-12-2-1-3-13-22)19-26-24-15-7-5-10-21(24)17-18-27(26)36-30(35)25-16-8-11-20-9-4-6-14-23(20)25/h1-19H,(H,32,33,34)/b28-19- |
| InChIKey | ROUYPAPYWIYSEI-USHMODERSA-N |
| XLogP | 7.10 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|