C26H18N2O4S2 — CID 137137638
[1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] benzenesulfonate (PubChem CID 137137638) has the molecular formula C26H18N2O4S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is [1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] benzenesulfonate.
| Compound Name | [1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] benzenesulfonate |
|---|---|
| PubChem CID | 137137638 |
| Molecular Formula | C26H18N2O4S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [1-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl] benzenesulfonate |
| SMILES | O=C1N/C(=N\c2ccccc2)S/C1=C\c1c(OS(=O)(=O)c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C26H18N2O4S2/c29-25-24(33-26(28-25)27-19-10-3-1-4-11-19)17-22-21-14-8-7-9-18(21)15-16-23(22)32-34(30,31)20-12-5-2-6-13-20/h1-17H,(H,27,28,29)/b24-17- |
| InChIKey | QOPOSBATHWVELP-ULJHMMPZSA-N |
| XLogP | 5.50 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|