C24H19IN2O5S2 — CID 137074419
[2-ethoxy-6-iodo-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 137074419) has the molecular formula C24H19IN2O5S2 and a molecular weight of 606.46 g/mol. Its IUPAC name is [2-ethoxy-6-iodo-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-6-iodo-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 137074419 |
| Molecular Formula | C24H19IN2O5S2 |
| Molecular Weight | 606.46 g/mol |
| Exact Mass | 605.98 |
| IUPAC Name | [2-ethoxy-6-iodo-4-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccccc3)NC2=O)cc(I)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19IN2O5S2/c1-2-31-20-14-16(13-19(25)22(20)32-34(29,30)18-11-7-4-8-12-18)15-21-23(28)27-24(33-21)26-17-9-5-3-6-10-17/h3-15H,2H2,1H3,(H,26,27,28)/b21-15- |
| InChIKey | MIPGSEZHNSZRKQ-QNGOZBTKSA-N |
| XLogP | 5.35 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|