C19H17IN2O3S — CID 137166618
(5Z)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137166618) has the molecular formula C19H17IN2O3S and a molecular weight of 480.33 g/mol. Its IUPAC name is (5Z)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137166618 |
| Molecular Formula | C19H17IN2O3S |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | (5Z)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccccc3)NC2=O)cc(I)c1OC |
| InChI | InChI=1S/C19H17IN2O3S/c1-3-25-15-10-12(9-14(20)17(15)24-2)11-16-18(23)22-19(26-16)21-13-7-5-4-6-8-13/h4-11H,3H2,1-2H3,(H,21,22,23)/b16-11- |
| InChIKey | WXVPXNBVLKGNEP-WJDWOHSUSA-N |
| XLogP | 4.59 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|