C23H16Cl2N2O5S2 — CID 135708592
[2-chloro-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate (PubChem CID 135708592) has the molecular formula C23H16Cl2N2O5S2 and a molecular weight of 535.43 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 135708592 |
| Molecular Formula | C23H16Cl2N2O5S2 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | [2-chloro-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc(Cl)cc3)NC2=O)cc(Cl)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16Cl2N2O5S2/c1-31-19-12-14(11-18(25)21(19)32-34(29,30)17-5-3-2-4-6-17)13-20-22(28)27-23(33-20)26-16-9-7-15(24)8-10-16/h2-13H,1H3,(H,26,27,28)/b20-13+ |
| InChIKey | HNGRKTUEGBNKSQ-DEDYPNTBSA-N |
| XLogP | 5.66 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|