C32H22N2O3S — CID 137043980
[1-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate (PubChem CID 137043980) has the molecular formula C32H22N2O3S and a molecular weight of 514.61 g/mol. Its IUPAC name is [1-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate.
| Compound Name | [1-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 137043980 |
| Molecular Formula | C32H22N2O3S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [1-[(Z)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl] naphthalene-1-carboxylate |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3c(OC(=O)c4cccc5ccccc45)ccc4ccccc34)S2)cc1 |
| InChI | InChI=1S/C32H22N2O3S/c1-20-13-16-23(17-14-20)33-32-34-30(35)29(38-32)19-27-25-11-5-3-8-22(25)15-18-28(27)37-31(36)26-12-6-9-21-7-2-4-10-24(21)26/h2-19H,1H3,(H,33,34,35)/b29-19- |
| InChIKey | MTPXXZSDTTZXGD-CEUNXORHSA-N |
| XLogP | 7.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|