C29H23N3O5S — CID 137079444
(5E)-2-(4-ethoxyphenyl)imino-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137079444) has the molecular formula C29H23N3O5S and a molecular weight of 525.59 g/mol. Its IUPAC name is (5E)-2-(4-ethoxyphenyl)imino-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-ethoxyphenyl)imino-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137079444 |
| Molecular Formula | C29H23N3O5S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (5E)-2-(4-ethoxyphenyl)imino-5-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3c(OCc4ccc([N+](=O)[O-])cc4)ccc4ccccc34)S2)cc1 |
| InChI | InChI=1S/C29H23N3O5S/c1-2-36-23-14-10-21(11-15-23)30-29-31-28(33)27(38-29)17-25-24-6-4-3-5-20(24)9-16-26(25)37-18-19-7-12-22(13-8-19)32(34)35/h3-17H,2,18H2,1H3,(H,30,31,33)/b27-17+ |
| InChIKey | SZCUPKCUPLUNNW-WPWMEQJKSA-N |
| XLogP | 6.62 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|