C30H24N4O7S2 — CID 136651900
2-[4-[[5-[(3-ethoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-nitrophenyl)sulfonylacetamide (PubChem CID 136651900) has the molecular formula C30H24N4O7S2 and a molecular weight of 616.68 g/mol. Its IUPAC name is 2-[4-[[5-[(3-ethoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-nitrophenyl)sulfonylacetamide.
| Compound Name | 2-[4-[[5-[(3-ethoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-nitrophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 136651900 |
| Molecular Formula | C30H24N4O7S2 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 2-[4-[[5-[(3-ethoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-nitrophenyl)sulfonylacetamide |
| SMILES | CCOc1cc2ccccc2cc1C=C1S/C(=N\c2ccc(CC(=O)NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)NC1=O |
| InChI | InChI=1S/C30H24N4O7S2/c1-2-41-26-17-21-6-4-3-5-20(21)16-22(26)18-27-29(36)32-30(42-27)31-23-9-7-19(8-10-23)15-28(35)33-43(39,40)25-13-11-24(12-14-25)34(37)38/h3-14,16-18H,2,15H2,1H3,(H,33,35)(H,31,32,36) |
| InChIKey | PVWANRXCWBTSJV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|