C32H28N3NaO5S2 — CID 173122584
sodium;hydride;N-(4-methylphenyl)sulfonyl-2-[4-[[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide (PubChem CID 173122584) has the molecular formula C32H28N3NaO5S2 and a molecular weight of 621.72 g/mol. Its IUPAC name is sodium;hydride;N-(4-methylphenyl)sulfonyl-2-[4-[[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide.
| Compound Name | sodium;hydride;N-(4-methylphenyl)sulfonyl-2-[4-[[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 173122584 |
| Molecular Formula | C32H28N3NaO5S2 |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | sodium;hydride;N-(4-methylphenyl)sulfonyl-2-[4-[[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Cc2ccc(/N=C3/NC(=O)/C(=C\c4ccccc4OCc4ccccc4)S3)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C32H27N3O5S2.Na.H/c1-22-11-17-27(18-12-22)42(38,39)35-30(36)19-23-13-15-26(16-14-23)33-32-34-31(37)29(41-32)20-25-9-5-6-10-28(25)40-21-24-7-3-2-4-8-24;;/h2-18,20H,19,21H2,1H3,(H,35,36)(H,33,34,37);;/q;+1;-1/b29-20+;; |
| InChIKey | SAMPPABICCDTON-YHFWERBDSA-N |
| XLogP | 2.63 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|