C31H24FN3NaO4S2 — CID 158209887
CID 158209887 (PubChem CID 158209887) has the molecular formula C31H24FN3NaO4S2 and a molecular weight of 608.67 g/mol.
| Compound Name | CID 158209887 |
|---|---|
| PubChem CID | 158209887 |
| Molecular Formula | C31H24FN3NaO4S2 |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Cc2ccc(/N=C3\NC(=O)C(=Cc4ccc(-c5ccccc5)c(F)c4)S3)cc2)cc1.[Na] |
| InChI | InChI=1S/C31H24FN3O4S2.Na/c1-20-7-14-25(15-8-20)41(38,39)35-29(36)19-21-9-12-24(13-10-21)33-31-34-30(37)28(40-31)18-22-11-16-26(27(32)17-22)23-5-3-2-4-6-23;/h2-18H,19H2,1H3,(H,35,36)(H,33,34,37); |
| InChIKey | GBYFIMYHIMQHTR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|