C30H25IN4O4S2 — CID 173142424
2-[4-[[5-[iodo-(4-methyl-3-pyrrol-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 173142424) has the molecular formula C30H25IN4O4S2 and a molecular weight of 696.59 g/mol. Its IUPAC name is 2-[4-[[5-[iodo-(4-methyl-3-pyrrol-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-[4-[[5-[iodo-(4-methyl-3-pyrrol-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 173142424 |
| Molecular Formula | C30H25IN4O4S2 |
| Molecular Weight | 696.59 g/mol |
| Exact Mass | 696.04 |
| IUPAC Name | 2-[4-[[5-[iodo-(4-methyl-3-pyrrol-1-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Cc2ccc(/N=C3\NC(=O)C(=C(I)c4ccc(C)c(-n5cccc5)c4)S3)cc2)cc1 |
| InChI | InChI=1S/C30H25IN4O4S2/c1-19-5-13-24(14-6-19)41(38,39)34-26(36)17-21-8-11-23(12-9-21)32-30-33-29(37)28(40-30)27(31)22-10-7-20(2)25(18-22)35-15-3-4-16-35/h3-16,18H,17H2,1-2H3,(H,34,36)(H,32,33,37) |
| InChIKey | BGIXXCSBNCLERN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|