C30H26N4O4S2 — CID 140534470
N-(4-methylphenyl)sulfonyl-2-[4-[[5-[[4-methyl-3-(1H-pyrrol-2-yl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide (PubChem CID 140534470) has the molecular formula C30H26N4O4S2 and a molecular weight of 570.70 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-2-[4-[[5-[[4-methyl-3-(1H-pyrrol-2-yl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-2-[4-[[5-[[4-methyl-3-(1H-pyrrol-2-yl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 140534470 |
| Molecular Formula | C30H26N4O4S2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-2-[4-[[5-[[4-methyl-3-(1H-pyrrol-2-yl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Cc2ccc(/N=C3/NC(=O)C(=Cc4ccc(C)c(-c5ccc[nH]5)c4)S3)cc2)cc1 |
| InChI | InChI=1S/C30H26N4O4S2/c1-19-5-13-24(14-6-19)40(37,38)34-28(35)18-21-9-11-23(12-10-21)32-30-33-29(36)27(39-30)17-22-8-7-20(2)25(16-22)26-4-3-15-31-26/h3-17,31H,18H2,1-2H3,(H,34,35)(H,32,33,36) |
| InChIKey | MUCPRMPJQSKNML-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|