C34H32N6NaO4S2 — CID 158162665
CID 158162665 (PubChem CID 158162665) has the molecular formula C34H32N6NaO4S2 and a molecular weight of 675.79 g/mol.
| Compound Name | CID 158162665 |
|---|---|
| PubChem CID | 158162665 |
| Molecular Formula | C34H32N6NaO4S2 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Cc2ccc(/N=C3/NC(=O)C(=Cc4ccc(N5CCN(c6ccccn6)CC5)cc4)S3)cc2)cc1.[Na] |
| InChI | InChI=1S/C34H32N6O4S2.Na/c1-24-5-15-29(16-6-24)46(43,44)38-32(41)23-26-7-11-27(12-8-26)36-34-37-33(42)30(45-34)22-25-9-13-28(14-10-25)39-18-20-40(21-19-39)31-4-2-3-17-35-31;/h2-17,22H,18-21,23H2,1H3,(H,38,41)(H,36,37,42); |
| InChIKey | FWLSUAHNFJCZON-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|