C29H23ClN3NaO5S2 — CID 173122628
sodium;N-(4-chlorophenyl)sulfonyl-2-[4-[[5-[(6-methoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide;hydride (PubChem CID 173122628) has the molecular formula C29H23ClN3NaO5S2 and a molecular weight of 616.10 g/mol. Its IUPAC name is sodium;N-(4-chlorophenyl)sulfonyl-2-[4-[[5-[(6-methoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide;hydride.
| Compound Name | sodium;N-(4-chlorophenyl)sulfonyl-2-[4-[[5-[(6-methoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide;hydride |
|---|---|
| PubChem CID | 173122628 |
| Molecular Formula | C29H23ClN3NaO5S2 |
| Molecular Weight | 616.10 g/mol |
| Exact Mass | 615.07 |
| IUPAC Name | sodium;N-(4-chlorophenyl)sulfonyl-2-[4-[[5-[(6-methoxynaphthalen-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide;hydride |
| SMILES | COc1ccc2cc(C=C3S/C(=N\c4ccc(CC(=O)NS(=O)(=O)c5ccc(Cl)cc5)cc4)NC3=O)ccc2c1.[H-].[Na+] |
| InChI | InChI=1S/C29H22ClN3O5S2.Na.H/c1-38-24-11-6-20-14-19(2-5-21(20)17-24)15-26-28(35)32-29(39-26)31-23-9-3-18(4-10-23)16-27(34)33-40(36,37)25-12-7-22(30)8-13-25;;/h2-15,17H,16H2,1H3,(H,33,34)(H,31,32,35);;/q;+1;-1 |
| InChIKey | FIJDNGDBSDVMOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|