C27H25N5O3S — CID 135541009
2-[4-[[(5Z)-4-oxo-5-[[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid (PubChem CID 135541009) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-[4-[[(5Z)-4-oxo-5-[[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(5Z)-4-oxo-5-[[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 135541009 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2-[4-[[(5Z)-4-oxo-5-[[3-(4-pyridin-2-ylpiperazin-1-yl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(/N=C2\NC(=O)/C(=C/c3cccc(N4CCN(c5ccccn5)CC4)c3)S2)cc1 |
| InChI | InChI=1S/C27H25N5O3S/c33-25(34)18-19-7-9-21(10-8-19)29-27-30-26(35)23(36-27)17-20-4-3-5-22(16-20)31-12-14-32(15-13-31)24-6-1-2-11-28-24/h1-11,16-17H,12-15,18H2,(H,33,34)(H,29,30,35)/b23-17- |
| InChIKey | ZUKODSKHSKZLBH-QJOMJCCJSA-N |
| XLogP | 3.93 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|