C25H17N3O3S — CID 135541041
2-[4-[[(5Z)-5-[[4-(2-cyanophenyl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid (PubChem CID 135541041) has the molecular formula C25H17N3O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-[4-[[(5Z)-5-[[4-(2-cyanophenyl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(5Z)-5-[[4-(2-cyanophenyl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 135541041 |
| Molecular Formula | C25H17N3O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[4-[[(5Z)-5-[[4-(2-cyanophenyl)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
| SMILES | N#Cc1ccccc1-c1ccc(/C=C2\S/C(=N/c3ccc(CC(=O)O)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C25H17N3O3S/c26-15-19-3-1-2-4-21(19)18-9-5-16(6-10-18)13-22-24(31)28-25(32-22)27-20-11-7-17(8-12-20)14-23(29)30/h1-13H,14H2,(H,29,30)(H,27,28,31)/b22-13- |
| InChIKey | KYZOQQNGDPUGMK-XKZIYDEJSA-N |
| XLogP | 4.74 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|