C24H16FN3O6S — CID 136501058
2-[4-[[5-[[4-(2-fluoro-4-nitrophenoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid (PubChem CID 136501058) has the molecular formula C24H16FN3O6S and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-[4-[[5-[[4-(2-fluoro-4-nitrophenoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[5-[[4-(2-fluoro-4-nitrophenoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 136501058 |
| Molecular Formula | C24H16FN3O6S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 2-[4-[[5-[[4-(2-fluoro-4-nitrophenoxy)phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(/N=C2\NC(=O)C(=Cc3ccc(Oc4ccc([N+](=O)[O-])cc4F)cc3)S2)cc1 |
| InChI | InChI=1S/C24H16FN3O6S/c25-19-13-17(28(32)33)7-10-20(19)34-18-8-3-14(4-9-18)11-21-23(31)27-24(35-21)26-16-5-1-15(2-6-16)12-22(29)30/h1-11,13H,12H2,(H,29,30)(H,26,27,31) |
| InChIKey | QBSSWOFWSKWASH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|