C17H11N3O6S — CID 135959422
2-hydroxy-4-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 135959422) has the molecular formula C17H11N3O6S and a molecular weight of 385.36 g/mol. Its IUPAC name is 2-hydroxy-4-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135959422 |
| Molecular Formula | C17H11N3O6S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-hydroxy-4-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C1N/C(=N\c2ccc(C(=O)O)c(O)c2)S/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H11N3O6S/c21-13-8-10(3-6-12(13)16(23)24)18-17-19-15(22)14(27-17)7-9-1-4-11(5-2-9)20(25)26/h1-8,21H,(H,23,24)(H,18,19,22)/b14-7- |
| InChIKey | IYMMBUWDFSOIEL-AUWJEWJLSA-N |
| XLogP | 2.89 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|