C18H11N3O7S — CID 135834631
5-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid (PubChem CID 135834631) has the molecular formula C18H11N3O7S and a molecular weight of 413.37 g/mol. Its IUPAC name is 5-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135834631 |
| Molecular Formula | C18H11N3O7S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 5-[[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C1N/C(=N\c2cc(C(=O)O)cc(C(=O)O)c2)S/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H11N3O7S/c22-15-14(5-9-1-3-13(4-2-9)21(27)28)29-18(20-15)19-12-7-10(16(23)24)6-11(8-12)17(25)26/h1-8H,(H,23,24)(H,25,26)(H,19,20,22)/b14-5- |
| InChIKey | IMEYFESYPHVZQK-RZNTYIFUSA-N |
| XLogP | 2.88 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|