C18H11ClN2O5S — CID 135834610
5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid (PubChem CID 135834610) has the molecular formula C18H11ClN2O5S and a molecular weight of 402.82 g/mol. Its IUPAC name is 5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135834610 |
| Molecular Formula | C18H11ClN2O5S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C1N/C(=N\c2cc(C(=O)O)cc(C(=O)O)c2)S/C1=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H11ClN2O5S/c19-12-3-1-2-9(4-12)5-14-15(22)21-18(27-14)20-13-7-10(16(23)24)6-11(8-13)17(25)26/h1-8H,(H,23,24)(H,25,26)(H,20,21,22)/b14-5- |
| InChIKey | PSKKVCMNUNGKSP-RZNTYIFUSA-N |
| XLogP | 3.63 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|