C20H19ClN2OS — CID 135834729
(5Z)-2-(4-butylphenyl)imino-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135834729) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is (5Z)-2-(4-butylphenyl)imino-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-butylphenyl)imino-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135834729 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (5Z)-2-(4-butylphenyl)imino-5-[(3-chlorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCc1ccc(/N=C2\NC(=O)/C(=C/c3cccc(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-2-3-5-14-8-10-17(11-9-14)22-20-23-19(24)18(25-20)13-15-6-4-7-16(21)12-15/h4,6-13H,2-3,5H2,1H3,(H,22,23,24)/b18-13- |
| InChIKey | BEGMXEIEIHTZQN-AQTBWJFISA-N |
| XLogP | 5.57 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|