C28H27ClN2O3S — CID 135733034
(5Z)-2-(4-butylphenyl)imino-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135733034) has the molecular formula C28H27ClN2O3S and a molecular weight of 507.06 g/mol. Its IUPAC name is (5Z)-2-(4-butylphenyl)imino-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-butylphenyl)imino-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135733034 |
| Molecular Formula | C28H27ClN2O3S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | (5Z)-2-(4-butylphenyl)imino-5-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCc1ccc(/N=C2\NC(=O)/C(=C/c3ccc(OCc4ccccc4Cl)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C28H27ClN2O3S/c1-3-4-7-19-10-13-22(14-11-19)30-28-31-27(32)26(35-28)17-20-12-15-24(25(16-20)33-2)34-18-21-8-5-6-9-23(21)29/h5-6,8-17H,3-4,7,18H2,1-2H3,(H,30,31,32)/b26-17- |
| InChIKey | LJKCADKXDWKNFB-ONUIUJJFSA-N |
| XLogP | 7.16 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|