C17H11ClN2O4S — CID 135948509
5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid (PubChem CID 135948509) has the molecular formula C17H11ClN2O4S and a molecular weight of 374.81 g/mol. Its IUPAC name is 5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135948509 |
| Molecular Formula | C17H11ClN2O4S |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 5-[[(5Z)-5-[(3-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
| SMILES | O=C1N/C(=N\c2ccc(O)c(C(=O)O)c2)S/C1=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H11ClN2O4S/c18-10-3-1-2-9(6-10)7-14-15(22)20-17(25-14)19-11-4-5-13(21)12(8-11)16(23)24/h1-8,21H,(H,23,24)(H,19,20,22)/b14-7- |
| InChIKey | PJXQGRKYOWZFNV-AUWJEWJLSA-N |
| XLogP | 3.64 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|