C19H16N2O6S — CID 135948491
5-[[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid (PubChem CID 135948491) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is 5-[[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135948491 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 5-[[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
| SMILES | COc1cccc(/C=C2\S/C(=N/c3ccc(O)c(C(=O)O)c3)NC2=O)c1OC |
| InChI | InChI=1S/C19H16N2O6S/c1-26-14-5-3-4-10(16(14)27-2)8-15-17(23)21-19(28-15)20-11-6-7-13(22)12(9-11)18(24)25/h3-9,22H,1-2H3,(H,24,25)(H,20,21,23)/b15-8- |
| InChIKey | OLUKZLMCODQLQY-NVNXTCNLSA-N |
| XLogP | 3.00 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|