C22H13ClN2O6S — CID 135834584
5-[[(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid (PubChem CID 135834584) has the molecular formula C22H13ClN2O6S and a molecular weight of 468.87 g/mol. Its IUPAC name is 5-[[(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135834584 |
| Molecular Formula | C22H13ClN2O6S |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 5-[[(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C1N/C(=N\c2cc(C(=O)O)cc(C(=O)O)c2)S/C1=C/c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C22H13ClN2O6S/c23-16-4-2-1-3-15(16)17-6-5-14(31-17)10-18-19(26)25-22(32-18)24-13-8-11(20(27)28)7-12(9-13)21(29)30/h1-10H,(H,27,28)(H,29,30)(H,24,25,26)/b18-10+ |
| InChIKey | AEIKHIIYTDXTTJ-VCHYOVAHSA-N |
| XLogP | 4.89 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|