C21H12Cl2N2O4S — CID 135483014
2-[[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 135483014) has the molecular formula C21H12Cl2N2O4S and a molecular weight of 459.31 g/mol. Its IUPAC name is 2-[[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 2-[[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135483014 |
| Molecular Formula | C21H12Cl2N2O4S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 2-[[5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C1N/C(=N/c2ccccc2C(=O)O)SC1=Cc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C21H12Cl2N2O4S/c22-11-5-7-15(23)14(9-11)17-8-6-12(29-17)10-18-19(26)25-21(30-18)24-16-4-2-1-3-13(16)20(27)28/h1-10H,(H,27,28)(H,24,25,26) |
| InChIKey | GPRBIAZEYGVMOW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|