C22H15ClN2O4S — CID 137118209
2-[5-[(Z)-[2-(5-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 137118209) has the molecular formula C22H15ClN2O4S and a molecular weight of 438.89 g/mol. Its IUPAC name is 2-[5-[(Z)-[2-(5-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(Z)-[2-(5-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 137118209 |
| Molecular Formula | C22H15ClN2O4S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 2-[5-[(Z)-[2-(5-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | Cc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2ccc(-c3ccccc3C(=O)O)o2)S1 |
| InChI | InChI=1S/C22H15ClN2O4S/c1-12-6-7-13(23)10-17(12)24-22-25-20(26)19(30-22)11-14-8-9-18(29-14)15-4-2-3-5-16(15)21(27)28/h2-11H,1H3,(H,27,28)(H,24,25,26)/b19-11- |
| InChIKey | PLLGSHHGFJTFAN-ODLFYWEKSA-N |
| XLogP | 5.50 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|