C21H13Cl2N3O3S — CID 135834489
2-[[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide (PubChem CID 135834489) has the molecular formula C21H13Cl2N3O3S and a molecular weight of 458.33 g/mol. Its IUPAC name is 2-[[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide.
| Compound Name | 2-[[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 135834489 |
| Molecular Formula | C21H13Cl2N3O3S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | 2-[[(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide |
| SMILES | NC(=O)c1ccccc1/N=C1/NC(=O)/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)S1 |
| InChI | InChI=1S/C21H13Cl2N3O3S/c22-14-7-5-11(9-15(14)23)17-8-6-12(29-17)10-18-20(28)26-21(30-18)25-16-4-2-1-3-13(16)19(24)27/h1-10H,(H2,24,27)(H,25,26,28)/b18-10+ |
| InChIKey | MFMNDXSKLVPAAM-VCHYOVAHSA-N |
| XLogP | 5.24 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|