C17H11Cl2N3O2S — CID 135834515
2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide (PubChem CID 135834515) has the molecular formula C17H11Cl2N3O2S and a molecular weight of 392.27 g/mol. Its IUPAC name is 2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide.
| Compound Name | 2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 135834515 |
| Molecular Formula | C17H11Cl2N3O2S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-[[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide |
| SMILES | NC(=O)c1ccccc1/N=C1\NC(=O)/C(=C/c2ccc(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C17H11Cl2N3O2S/c18-10-6-5-9(12(19)8-10)7-14-16(24)22-17(25-14)21-13-4-2-1-3-11(13)15(20)23/h1-8H,(H2,20,23)(H,21,22,24)/b14-7- |
| InChIKey | APEHMNVEAJAVEQ-AUWJEWJLSA-N |
| XLogP | 3.98 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|