C17H10Cl2N2O3S — CID 135948022
2-[(E)-[2-(2,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 135948022) has the molecular formula C17H10Cl2N2O3S and a molecular weight of 393.25 g/mol. Its IUPAC name is 2-[(E)-[2-(2,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[2-(2,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 135948022 |
| Molecular Formula | C17H10Cl2N2O3S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 2-[(E)-[2-(2,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C1N/C(=N/c2ccc(Cl)cc2Cl)S/C1=C/c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H10Cl2N2O3S/c18-10-5-6-13(12(19)8-10)20-17-21-15(22)14(25-17)7-9-3-1-2-4-11(9)16(23)24/h1-8H,(H,23,24)(H,20,21,22)/b14-7+ |
| InChIKey | NLCFBWZGHAEABN-VGOFMYFVSA-N |
| XLogP | 4.58 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|