C11H8Cl2N4OS2 — CID 137265880
[(Z)-[(5E)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea (PubChem CID 137265880) has the molecular formula C11H8Cl2N4OS2 and a molecular weight of 347.25 g/mol. Its IUPAC name is [(Z)-[(5E)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(5E)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 137265880 |
| Molecular Formula | C11H8Cl2N4OS2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | [(Z)-[(5E)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C1/NC(=O)/C(=C\c2ccc(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C11H8Cl2N4OS2/c12-6-2-1-5(7(13)4-6)3-8-9(18)15-11(20-8)17-16-10(14)19/h1-4H,(H3,14,16,19)(H,15,17,18)/b8-3+ |
| InChIKey | GBAAKHKPSFJKHF-FPYGCLRLSA-N |
| XLogP | 2.30 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|