C20H12Cl2N2O3S2 — CID 147110511
N-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide (PubChem CID 147110511) has the molecular formula C20H12Cl2N2O3S2 and a molecular weight of 463.37 g/mol. Its IUPAC name is N-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide.
| Compound Name | N-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 147110511 |
| Molecular Formula | C20H12Cl2N2O3S2 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | N-[(5Z)-5-[(2,4-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]naphthalene-1-sulfonamide |
| SMILES | O=C1NC(=NS(=O)(=O)c2cccc3ccccc23)S/C1=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H12Cl2N2O3S2/c21-14-9-8-13(16(22)11-14)10-17-19(25)23-20(28-17)24-29(26,27)18-7-3-5-12-4-1-2-6-15(12)18/h1-11H,(H,23,24,25)/b17-10- |
| InChIKey | BMKKOIWHXMLHRI-YVLHZVERSA-N |
| XLogP | 5.10 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|