C21H12ClF3N2OS — CID 135523358
2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135523358) has the molecular formula C21H12ClF3N2OS and a molecular weight of 432.85 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135523358 |
| Molecular Formula | C21H12ClF3N2OS |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-(naphthalen-1-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(Cl)c(C(F)(F)F)c2)SC1=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H12ClF3N2OS/c22-17-9-8-14(11-16(17)21(23,24)25)26-20-27-19(28)18(29-20)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-11H,(H,26,27,28) |
| InChIKey | OPTMYIJFOLUQCK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|