C17H9ClF4N2OS — CID 135416511
2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135416511) has the molecular formula C17H9ClF4N2OS and a molecular weight of 400.78 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135416511 |
| Molecular Formula | C17H9ClF4N2OS |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(Cl)c(C(F)(F)F)c2)SC1=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H9ClF4N2OS/c18-13-6-5-11(8-12(13)17(20,21)22)23-16-24-15(25)14(26-16)7-9-1-3-10(19)4-2-9/h1-8H,(H,23,24,25) |
| InChIKey | YGCUFMMYQGZYSR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|