C16H9Cl3N2OS — CID 136782340
(5E)-5-[(4-chlorophenyl)methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136782340) has the molecular formula C16H9Cl3N2OS and a molecular weight of 383.69 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136782340 |
| Molecular Formula | C16H9Cl3N2OS |
| Molecular Weight | 383.69 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-(3,4-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)c(Cl)c2)S/C1=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H9Cl3N2OS/c17-10-3-1-9(2-4-10)7-14-15(22)21-16(23-14)20-11-5-6-12(18)13(19)8-11/h1-8H,(H,20,21,22)/b14-7+ |
| InChIKey | NKBFVZSMDNZQQC-VGOFMYFVSA-N |
| XLogP | 5.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|