C19H11ClN2O3S — CID 155531374
(5E)-5-[(4-chlorophenyl)methylidene]-2-(2-oxochromen-6-yl)imino-1,3-thiazolidin-4-one (PubChem CID 155531374) has the molecular formula C19H11ClN2O3S and a molecular weight of 382.83 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-2-(2-oxochromen-6-yl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-(2-oxochromen-6-yl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155531374 |
| Molecular Formula | C19H11ClN2O3S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-(2-oxochromen-6-yl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc3oc(=O)ccc3c2)S/C1=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H11ClN2O3S/c20-13-4-1-11(2-5-13)9-16-18(24)22-19(26-16)21-14-6-7-15-12(10-14)3-8-17(23)25-15/h1-10H,(H,21,22,24)/b16-9+ |
| InChIKey | VJCSKCRTROHSRP-CXUHLZMHSA-N |
| XLogP | 4.34 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|