C17H8Cl3F3N2OS — CID 135523178
2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135523178) has the molecular formula C17H8Cl3F3N2OS and a molecular weight of 451.68 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135523178 |
| Molecular Formula | C17H8Cl3F3N2OS |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(Cl)c(C(F)(F)F)c2)SC1=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H8Cl3F3N2OS/c18-9-2-1-8(13(20)6-9)5-14-15(26)25-16(27-14)24-10-3-4-12(19)11(7-10)17(21,22)23/h1-7H,(H,24,25,26) |
| InChIKey | SEEUPOPHKPFCOH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|