C10H6Cl2N2O2S — CID 135432394
5-[(2,4-dichlorophenyl)methylidene]-2-hydroxyimino-1,3-thiazolidin-4-one (PubChem CID 135432394) has the molecular formula C10H6Cl2N2O2S and a molecular weight of 289.14 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methylidene]-2-hydroxyimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,4-dichlorophenyl)methylidene]-2-hydroxyimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135432394 |
| Molecular Formula | C10H6Cl2N2O2S |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methylidene]-2-hydroxyimino-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NO)SC1=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2S/c11-6-2-1-5(7(12)4-6)3-8-9(15)13-10(14-16)17-8/h1-4,16H,(H,13,14,15) |
| InChIKey | BBEUQHFNLLHWNO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|