C17H9Cl3N4O3S — CID 135828153
(2E)-2-[(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135828153) has the molecular formula C17H9Cl3N4O3S and a molecular weight of 455.71 g/mol. Its IUPAC name is (2E)-2-[(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135828153 |
| Molecular Formula | C17H9Cl3N4O3S |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | (2E)-2-[(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=Cc2ccc(Cl)c([N+](=O)[O-])c2)SC1=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H9Cl3N4O3S/c18-11-3-2-10(13(20)7-11)6-15-16(25)22-17(28-15)23-21-8-9-1-4-12(19)14(5-9)24(26)27/h1-8H,(H,22,23,25) |
| InChIKey | GFQXJLBSOGEKFJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|