C22H12Cl2N4O6S — CID 135537309
2-chloro-5-[5-[(E)-[(2E)-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 135537309) has the molecular formula C22H12Cl2N4O6S and a molecular weight of 531.33 g/mol. Its IUPAC name is 2-chloro-5-[5-[(E)-[(2E)-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(E)-[(2E)-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 135537309 |
| Molecular Formula | C22H12Cl2N4O6S |
| Molecular Weight | 531.33 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | 2-chloro-5-[5-[(E)-[(2E)-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1N/C(=N\N=C\c2ccc(Cl)c([N+](=O)[O-])c2)S/C1=C/c1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C22H12Cl2N4O6S/c23-15-5-2-12(8-14(15)21(30)31)18-6-3-13(34-18)9-19-20(29)26-22(35-19)27-25-10-11-1-4-16(24)17(7-11)28(32)33/h1-10H,(H,30,31)(H,26,27,29)/b19-9+,25-10+ |
| InChIKey | SYFKNEUQVICNMK-UTKOBFNXSA-N |
| XLogP | 5.45 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|