C21H14N4O4S — CID 135413269
2-(benzylidenehydrazinylidene)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135413269) has the molecular formula C21H14N4O4S and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-(benzylidenehydrazinylidene)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(benzylidenehydrazinylidene)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135413269 |
| Molecular Formula | C21H14N4O4S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-(benzylidenehydrazinylidene)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NN=Cc2ccccc2)SC1=Cc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H14N4O4S/c26-20-19(30-21(23-20)24-22-13-14-6-2-1-3-7-14)12-15-10-11-18(29-15)16-8-4-5-9-17(16)25(27)28/h1-13H,(H,23,24,26) |
| InChIKey | YRDMQKNVBQBYKY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|