C15H9N3O5S — CID 140752039
N-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]formamide (PubChem CID 140752039) has the molecular formula C15H9N3O5S and a molecular weight of 343.32 g/mol. Its IUPAC name is N-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]formamide.
| Compound Name | N-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]formamide |
|---|---|
| PubChem CID | 140752039 |
| Molecular Formula | C15H9N3O5S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]formamide |
| SMILES | O=C/N=C1\NC(=O)/C(=C/c2ccc(-c3ccccc3[N+](=O)[O-])o2)S1 |
| InChI | InChI=1S/C15H9N3O5S/c19-8-16-15-17-14(20)13(24-15)7-9-5-6-12(23-9)10-3-1-2-4-11(10)18(21)22/h1-8H,(H,16,17,19,20)/b13-7- |
| InChIKey | PMKPWQLRHCZFTO-QPEQYQDCSA-N |
| XLogP | 2.57 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|