C15H10N4O5S — CID 137003806
(E)-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 137003806) has the molecular formula C15H10N4O5S and a molecular weight of 358.34 g/mol. Its IUPAC name is (E)-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (E)-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 137003806 |
| Molecular Formula | C15H10N4O5S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (E)-[(5Z)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | NC(=O)/N=C1\NC(=O)/C(=C/c2ccc(-c3ccccc3[N+](=O)[O-])o2)S1 |
| InChI | InChI=1S/C15H10N4O5S/c16-14(21)18-15-17-13(20)12(25-15)7-8-5-6-11(24-8)9-3-1-2-4-10(9)19(22)23/h1-7H,(H3,16,17,18,20,21)/b12-7- |
| InChIKey | UIBVLAIUPNWJHL-GHXNOFRVSA-N |
| XLogP | 2.49 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|