C17H9Cl2N5O5S — CID 135419575
(2Z,5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135419575) has the molecular formula C17H9Cl2N5O5S and a molecular weight of 466.26 g/mol. Its IUPAC name is (2Z,5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135419575 |
| Molecular Formula | C17H9Cl2N5O5S |
| Molecular Weight | 466.26 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | (2Z,5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-[(E)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C/c2ccc(Cl)c([N+](=O)[O-])c2)S/C1=C/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H9Cl2N5O5S/c18-11-3-1-9(5-13(11)23(26)27)7-15-16(25)21-17(30-15)22-20-8-10-2-4-12(19)14(6-10)24(28)29/h1-8H,(H,21,22,25)/b15-7+,20-8+ |
| InChIKey | INWVIOBOTYOJKF-ZTJKHUJPSA-N |
| XLogP | 4.40 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|