C17H10Cl2N4O3S — CID 135460162
2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135460162) has the molecular formula C17H10Cl2N4O3S and a molecular weight of 421.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135460162 |
| Molecular Formula | C17H10Cl2N4O3S |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(4-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NN=Cc2ccc(Cl)cc2Cl)SC1=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H10Cl2N4O3S/c18-12-4-3-11(14(19)8-12)9-20-22-17-21-16(24)15(27-17)7-10-1-5-13(6-2-10)23(25)26/h1-9H,(H,21,22,24) |
| InChIKey | WRRPXWQDVKGYDQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|