C18H12Cl2N4O4S — CID 135599259
(2E,5E)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135599259) has the molecular formula C18H12Cl2N4O4S and a molecular weight of 451.29 g/mol. Its IUPAC name is (2E,5E)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135599259 |
| Molecular Formula | C18H12Cl2N4O4S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | (2E,5E)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-5-[(2-methoxy-5-nitrophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc([N+](=O)[O-])cc1/C=C1/S/C(=N/N=C\c2ccc(Cl)cc2Cl)NC1=O |
| InChI | InChI=1S/C18H12Cl2N4O4S/c1-28-15-5-4-13(24(26)27)6-11(15)7-16-17(25)22-18(29-16)23-21-9-10-2-3-12(19)8-14(10)20/h2-9H,1H3,(H,22,23,25)/b16-7+,21-9- |
| InChIKey | ACGKHXRJISVMES-MVSUSHIPSA-N |
| XLogP | 4.50 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|